C23H37NO3S — CID 71610144
(2S)-1-(10,10-dimethyl-3,3-dioxo-2-prop-2-enyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-2-prop-2-enylheptan-1-one (PubChem CID 71610144) has the molecular formula C23H37NO3S and a molecular weight of 407.62 g/mol. Its IUPAC name is (2S)-1-(10,10-dimethyl-3,3-dioxo-2-prop-2-enyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-2-prop-2-enylheptan-1-one.
| Compound Name | (2S)-1-(10,10-dimethyl-3,3-dioxo-2-prop-2-enyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-2-prop-2-enylheptan-1-one |
|---|---|
| PubChem CID | 71610144 |
| Molecular Formula | C23H37NO3S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (2S)-1-(10,10-dimethyl-3,3-dioxo-2-prop-2-enyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-2-prop-2-enylheptan-1-one |
| SMILES | C=CCC1C23CCC(CC2N(C(=O)[C@H](CC=C)CCCCC)S1(=O)=O)C3(C)C |
| InChI | InChI=1S/C23H37NO3S/c1-6-9-10-13-17(11-7-2)21(25)24-19-16-18-14-15-23(19,22(18,4)5)20(12-8-3)28(24,26)27/h7-8,17-20H,2-3,6,9-16H2,1,4-5H3/t17-,18?,19?,20?,23?/m1/s1 |
| InChIKey | VHJSKPKNGLEGAK-HYMXPIOVSA-N |
| XLogP | 5.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|