C15H20O — CID 102014936
(5E)-5-benzylidene-2,2,4-trimethylcyclopentan-1-ol (PubChem CID 102014936) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (5E)-5-benzylidene-2,2,4-trimethylcyclopentan-1-ol.
| Compound Name | (5E)-5-benzylidene-2,2,4-trimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 102014936 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (5E)-5-benzylidene-2,2,4-trimethylcyclopentan-1-ol |
| SMILES | CC1CC(C)(C)C(O)/C1=C/c1ccccc1 |
| InChI | InChI=1S/C15H20O/c1-11-10-15(2,3)14(16)13(11)9-12-7-5-4-6-8-12/h4-9,11,14,16H,10H2,1-3H3/b13-9+ |
| InChIKey | HDAMQHKUQVBFPH-UKTHLTGXSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |