C13H19BrO2 — CID 144977863
bromobenzene;formic acid;1,1,2-trimethylcyclopropane (PubChem CID 144977863) has the molecular formula C13H19BrO2 and a molecular weight of 287.20 g/mol. Its IUPAC name is bromobenzene;formic acid;1,1,2-trimethylcyclopropane.
| Compound Name | bromobenzene;formic acid;1,1,2-trimethylcyclopropane |
|---|---|
| PubChem CID | 144977863 |
| Molecular Formula | C13H19BrO2 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | bromobenzene;formic acid;1,1,2-trimethylcyclopropane |
| SMILES | Brc1ccccc1.CC1CC1(C)C.O=CO |
| InChI | InChI=1S/C6H5Br.C6H12.CH2O2/c7-6-4-2-1-3-5-6;1-5-4-6(5,2)3;2-1-3/h1-5H;5H,4H2,1-3H3;1H,(H,2,3) |
| InChIKey | KBBYMQCVGKOKKS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|