C18H16O2 — CID 132510708
(1-benzoyl-2-methylcyclopropyl)-phenylmethanone (PubChem CID 132510708) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1-benzoyl-2-methylcyclopropyl)-phenylmethanone.
| Compound Name | (1-benzoyl-2-methylcyclopropyl)-phenylmethanone |
|---|---|
| PubChem CID | 132510708 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1-benzoyl-2-methylcyclopropyl)-phenylmethanone |
| SMILES | CC1CC1(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16O2/c1-13-12-18(13,16(19)14-8-4-2-5-9-14)17(20)15-10-6-3-7-11-15/h2-11,13H,12H2,1H3 |
| InChIKey | LPXUOIFBUQGUDG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|