About [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone
[(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone (PubChem CID 7377399) has the molecular formula C14H20NO2+
and a molecular weight of 234.32 g/mol. Its IUPAC name is [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone |
| PubChem CID | 7377399 |
| Molecular Formula | C14H20NO2+ |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone |
| SMILES | C[C@H]1C[NH+](C)CC[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-11-10-15(2)9-8-14(11,17)13(16)12-6-4-3-5-7-12/h3-7,11,17H,8-10H2,1-2H3/p+1/t11-,14+/m0/s1 |
| InChIKey | FVSPEICUIGLILX-SMDDNHRTSA-O |
| XLogP | 0.15 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone?
The IUPAC name of [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone (CID 7377399) is [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone.
What is the SMILES notation for [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone?
The canonical SMILES for [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone is C[C@H]1C[NH+](C)CC[C@]1(O)C(=O)c1ccccc1.
What is the InChIKey of [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone?
The InChIKey is FVSPEICUIGLILX-SMDDNHRTSA-O. The full InChI is InChI=1S/C14H19NO2/c1-11-10-15(2)9-8-14(11,17)13(16)12-6-4-3-5-7-12/h3-7,11,17H,8-10H2,1-2H3/p+1/t11-,14+/m0/s1.
What are the key properties of [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone?
[(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone has a molecular weight of 234.32 g/mol, XLogP of 0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-hydroxy-1,3-dimethylpiperidin-1-ium-4-yl]-phenylmethanone is sourced from PubChem (CID 7377399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).