C14H19NO2 — CID 7377398
[(3R,4R)-4-hydroxy-1,3-dimethylpiperidin-4-yl]-phenylmethanone (PubChem CID 7377398) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is [(3R,4R)-4-hydroxy-1,3-dimethylpiperidin-4-yl]-phenylmethanone.
| Compound Name | [(3R,4R)-4-hydroxy-1,3-dimethylpiperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7377398 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | [(3R,4R)-4-hydroxy-1,3-dimethylpiperidin-4-yl]-phenylmethanone |
| SMILES | C[C@@H]1CN(C)CC[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-11-10-15(2)9-8-14(11,17)13(16)12-6-4-3-5-7-12/h3-7,11,17H,8-10H2,1-2H3/t11-,14-/m1/s1 |
| InChIKey | FVSPEICUIGLILX-BXUZGUMPSA-N |
| XLogP | 1.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |