C14H22ClNO — CID 126467809
1,3,5-trimethyl-4-phenylpiperidin-4-ol;hydrochloride (PubChem CID 126467809) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is 1,3,5-trimethyl-4-phenylpiperidin-4-ol;hydrochloride.
| Compound Name | 1,3,5-trimethyl-4-phenylpiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 126467809 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1,3,5-trimethyl-4-phenylpiperidin-4-ol;hydrochloride |
| SMILES | CC1CN(C)CC(C)C1(O)c1ccccc1.Cl |
| InChI | InChI=1S/C14H21NO.ClH/c1-11-9-15(3)10-12(2)14(11,16)13-7-5-4-6-8-13;/h4-8,11-12,16H,9-10H2,1-3H3;1H |
| InChIKey | XBFKPYFBPAZJPJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |