C17H18O — CID 10537911
(1S,3S)-1,3-dimethyl-2-phenyl-1,3-dihydroinden-2-ol (PubChem CID 10537911) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is (1S,3S)-1,3-dimethyl-2-phenyl-1,3-dihydroinden-2-ol.
| Compound Name | (1S,3S)-1,3-dimethyl-2-phenyl-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 10537911 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (1S,3S)-1,3-dimethyl-2-phenyl-1,3-dihydroinden-2-ol |
| SMILES | C[C@H]1c2ccccc2[C@H](C)C1(O)c1ccccc1 |
| InChI | InChI=1S/C17H18O/c1-12-15-10-6-7-11-16(15)13(2)17(12,18)14-8-4-3-5-9-14/h3-13,18H,1-2H3/t12-,13-/m0/s1 |
| InChIKey | DDUPFWKEUNZYNN-STQMWFEESA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |