C16H16O — CID 14449205
(1R,2R)-1-methyl-2-phenyl-1,3-dihydroinden-2-ol (PubChem CID 14449205) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is (1R,2R)-1-methyl-2-phenyl-1,3-dihydroinden-2-ol.
| Compound Name | (1R,2R)-1-methyl-2-phenyl-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 14449205 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (1R,2R)-1-methyl-2-phenyl-1,3-dihydroinden-2-ol |
| SMILES | C[C@@H]1c2ccccc2C[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C16H16O/c1-12-15-10-6-5-7-13(15)11-16(12,17)14-8-3-2-4-9-14/h2-10,12,17H,11H2,1H3/t12-,16-/m1/s1 |
| InChIKey | CJTIWPLAKOZKEO-MLGOLLRUSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |