C10H11BrO — CID 174888924
1-bromo-2-methyl-1,3-dihydroinden-2-ol (PubChem CID 174888924) has the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. Its IUPAC name is 1-bromo-2-methyl-1,3-dihydroinden-2-ol.
| Compound Name | 1-bromo-2-methyl-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 174888924 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 1-bromo-2-methyl-1,3-dihydroinden-2-ol |
| SMILES | CC1(O)Cc2ccccc2C1Br |
| InChI | InChI=1S/C10H11BrO/c1-10(12)6-7-4-2-3-5-8(7)9(10)11/h2-5,9,12H,6H2,1H3 |
| InChIKey | AHKXHXSQASPPSU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|