C16H15NO — CID 135017650
(6aR,11bS)-5,6,7,11b-tetrahydroindeno[2,1-c]quinolin-6a-ol (PubChem CID 135017650) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (6aR,11bS)-5,6,7,11b-tetrahydroindeno[2,1-c]quinolin-6a-ol.
| Compound Name | (6aR,11bS)-5,6,7,11b-tetrahydroindeno[2,1-c]quinolin-6a-ol |
|---|---|
| PubChem CID | 135017650 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (6aR,11bS)-5,6,7,11b-tetrahydroindeno[2,1-c]quinolin-6a-ol |
| SMILES | O[C@@]12CNc3ccccc3[C@@H]1c1ccccc1C2 |
| InChI | InChI=1S/C16H15NO/c18-16-9-11-5-1-2-6-12(11)15(16)13-7-3-4-8-14(13)17-10-16/h1-8,15,17-18H,9-10H2/t15-,16-/m0/s1 |
| InChIKey | DUJGZZGYAYCEGP-HOTGVXAUSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |