C16H13NO2 — CID 134951476
(1S,2S)-1-hydroxyspiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one (PubChem CID 134951476) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is (1S,2S)-1-hydroxyspiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one.
| Compound Name | (1S,2S)-1-hydroxyspiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 134951476 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (1S,2S)-1-hydroxyspiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccccc2[C@]12Cc1ccccc1[C@@H]2O |
| InChI | InChI=1S/C16H13NO2/c18-14-11-6-2-1-5-10(11)9-16(14)12-7-3-4-8-13(12)17-15(16)19/h1-8,14,18H,9H2,(H,17,19)/t14-,16-/m0/s1 |
| InChIKey | VMSKIRDPGUEJCO-HOCLYGCPSA-N |
| XLogP | 2.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |