C13H16N2O — CID 131857394
(2'S,3S)-2'-ethylspiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 131857394) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (2'S,3S)-2'-ethylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'S,3S)-2'-ethylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 131857394 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (2'S,3S)-2'-ethylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC[C@@H]1NCC[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C13H16N2O/c1-2-11-13(7-8-14-11)9-5-3-4-6-10(9)15-12(13)16/h3-6,11,14H,2,7-8H2,1H3,(H,15,16)/t11-,13-/m0/s1 |
| InChIKey | GOFSRVZDVQBWTO-AAEUAGOBSA-N |
| XLogP | 1.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |