C15H17NO2 — CID 102181510
(3S,3'R)-3'-(2-hydroxyethyl)spiro[1H-indole-3,4'-cyclohexene]-2-one (PubChem CID 102181510) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (3S,3'R)-3'-(2-hydroxyethyl)spiro[1H-indole-3,4'-cyclohexene]-2-one.
| Compound Name | (3S,3'R)-3'-(2-hydroxyethyl)spiro[1H-indole-3,4'-cyclohexene]-2-one |
|---|---|
| PubChem CID | 102181510 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (3S,3'R)-3'-(2-hydroxyethyl)spiro[1H-indole-3,4'-cyclohexene]-2-one |
| SMILES | O=C1Nc2ccccc2[C@@]12CCC=C[C@H]2CCO |
| InChI | InChI=1S/C15H17NO2/c17-10-8-11-5-3-4-9-15(11)12-6-1-2-7-13(12)16-14(15)18/h1-3,5-7,11,17H,4,8-10H2,(H,16,18)/t11-,15-/m0/s1 |
| InChIKey | MWWGPVXOBMTLIN-NHYWBVRUSA-N |
| XLogP | 2.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|