C22H26N2O5S — CID 171322090
(2'S,3R)-1'-ethylsulfonyl-2'-(2-phenylethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid (PubChem CID 171322090) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is (2'S,3R)-1'-ethylsulfonyl-2'-(2-phenylethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid.
| Compound Name | (2'S,3R)-1'-ethylsulfonyl-2'-(2-phenylethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid |
|---|---|
| PubChem CID | 171322090 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (2'S,3R)-1'-ethylsulfonyl-2'-(2-phenylethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid |
| SMILES | CCS(=O)(=O)N1CC[C@]2(C(=O)Nc3ccccc32)[C@@H]1CCc1ccccc1.O=CO |
| InChI | InChI=1S/C21H24N2O3S.CH2O2/c1-2-27(25,26)23-15-14-21(17-10-6-7-11-18(17)22-20(21)24)19(23)13-12-16-8-4-3-5-9-16;2-1-3/h3-11,19H,2,12-15H2,1H3,(H,22,24);1H,(H,2,3)/t19-,21+;/m0./s1 |
| InChIKey | BCMIMOKOXCVFRP-LZAGWAHOSA-N |
| XLogP | 2.63 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|