C21H23N3O5S — CID 171322596
1'-(cyclopropylmethylsulfonyl)-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid (PubChem CID 171322596) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 1'-(cyclopropylmethylsulfonyl)-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid.
| Compound Name | 1'-(cyclopropylmethylsulfonyl)-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid |
|---|---|
| PubChem CID | 171322596 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1'-(cyclopropylmethylsulfonyl)-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one;formic acid |
| SMILES | O=C1Nc2ccccc2C12CCN(S(=O)(=O)CC1CC1)C2c1cccnc1.O=CO |
| InChI | InChI=1S/C20H21N3O3S.CH2O2/c24-19-20(16-5-1-2-6-17(16)22-19)9-11-23(27(25,26)13-14-7-8-14)18(20)15-4-3-10-21-12-15;2-1-3/h1-6,10,12,14,18H,7-9,11,13H2,(H,22,24);1H,(H,2,3) |
| InChIKey | WZDPYNIAJMRULG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|