C24H29N3O4 — CID 171712728
formic acid;(2'S,3R)-1'-[2-[methyl(propan-2-yl)amino]acetyl]-2'-phenylspiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 171712728) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is formic acid;(2'S,3R)-1'-[2-[methyl(propan-2-yl)amino]acetyl]-2'-phenylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | formic acid;(2'S,3R)-1'-[2-[methyl(propan-2-yl)amino]acetyl]-2'-phenylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 171712728 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | formic acid;(2'S,3R)-1'-[2-[methyl(propan-2-yl)amino]acetyl]-2'-phenylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CC(C)N(C)CC(=O)N1CC[C@]2(C(=O)Nc3ccccc32)[C@@H]1c1ccccc1.O=CO |
| InChI | InChI=1S/C23H27N3O2.CH2O2/c1-16(2)25(3)15-20(27)26-14-13-23(21(26)17-9-5-4-6-10-17)18-11-7-8-12-19(18)24-22(23)28;2-1-3/h4-12,16,21H,13-15H2,1-3H3,(H,24,28);1H,(H,2,3)/t21-,23+;/m0./s1 |
| InChIKey | KNPODLJQUIZFAA-ITOBZAKTSA-N |
| XLogP | 2.89 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|