C12H17NO2 — CID 158151574
3,3-dimethyl-1H-indol-2-one;ethanol (PubChem CID 158151574) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3,3-dimethyl-1H-indol-2-one;ethanol.
| Compound Name | 3,3-dimethyl-1H-indol-2-one;ethanol |
|---|---|
| PubChem CID | 158151574 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3,3-dimethyl-1H-indol-2-one;ethanol |
| SMILES | CC1(C)C(=O)Nc2ccccc21.CCO |
| InChI | InChI=1S/C10H11NO.C2H6O/c1-10(2)7-5-3-4-6-8(7)11-9(10)12;1-2-3/h3-6H,1-2H3,(H,11,12);3H,2H2,1H3 |
| InChIKey | FVEGIPVAXAAJJA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |