About CID 146949857
CID 146949857 (PubChem CID 146949857) has the molecular formula C8H7AlN2O
and a molecular weight of 174.14 g/mol.
Molecular Properties
| Compound Name | CID 146949857 |
| PubChem CID | 146949857 |
| Molecular Formula | C8H7AlN2O |
| Molecular Weight | 174.14 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | — |
| SMILES | NC1([Al])C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C8H7N2O.Al/c9-7-5-3-1-2-4-6(5)10-8(7)11;/h1-4H,9H2,(H,10,11); |
| InChIKey | SFJCDBUVBULXJJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.14 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 146949857 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146949857?
The IUPAC name of CID 146949857 (CID 146949857) is not available.
What is the SMILES notation for CID 146949857?
The canonical SMILES for CID 146949857 is NC1([Al])C(=O)Nc2ccccc21.
What is the InChIKey of CID 146949857?
The InChIKey is SFJCDBUVBULXJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2O.Al/c9-7-5-3-1-2-4-6(5)10-8(7)11;/h1-4H,9H2,(H,10,11);.
What are the key properties of CID 146949857?
CID 146949857 has a molecular weight of 174.14 g/mol, XLogP of -0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146949857 is sourced from PubChem (CID 146949857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).