C18H25NO5 — CID 143412734
ethane;ethyl 2-[3-(2-ethoxy-2-oxoethyl)-2-oxo-1H-indol-3-yl]acetate (PubChem CID 143412734) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethane;ethyl 2-[3-(2-ethoxy-2-oxoethyl)-2-oxo-1H-indol-3-yl]acetate.
| Compound Name | ethane;ethyl 2-[3-(2-ethoxy-2-oxoethyl)-2-oxo-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 143412734 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | ethane;ethyl 2-[3-(2-ethoxy-2-oxoethyl)-2-oxo-1H-indol-3-yl]acetate |
| SMILES | CC.CCOC(=O)CC1(CC(=O)OCC)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C16H19NO5.C2H6/c1-3-21-13(18)9-16(10-14(19)22-4-2)11-7-5-6-8-12(11)17-15(16)20;1-2/h5-8H,3-4,9-10H2,1-2H3,(H,17,20);1-2H3 |
| InChIKey | PKLZDAKIKAQNSI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |