C11H10FNO3 — CID 11195429
ethyl 3-fluoro-2-oxo-1H-indole-3-carboxylate (PubChem CID 11195429) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is ethyl 3-fluoro-2-oxo-1H-indole-3-carboxylate.
| Compound Name | ethyl 3-fluoro-2-oxo-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 11195429 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | ethyl 3-fluoro-2-oxo-1H-indole-3-carboxylate |
| SMILES | CCOC(=O)C1(F)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H10FNO3/c1-2-16-10(15)11(12)7-5-3-4-6-8(7)13-9(11)14/h3-6H,2H2,1H3,(H,13,14) |
| InChIKey | YJQZGCHDEBEHEJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|