C19H17NO4 — CID 102347352
ethyl (4S)-4-benzyl-2,3-dioxo-1H-quinoline-4-carboxylate (PubChem CID 102347352) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is ethyl (4S)-4-benzyl-2,3-dioxo-1H-quinoline-4-carboxylate.
| Compound Name | ethyl (4S)-4-benzyl-2,3-dioxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 102347352 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | ethyl (4S)-4-benzyl-2,3-dioxo-1H-quinoline-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2)C(=O)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C19H17NO4/c1-2-24-18(23)19(12-13-8-4-3-5-9-13)14-10-6-7-11-15(14)20-17(22)16(19)21/h3-11H,2,12H2,1H3,(H,20,22)/t19-/m0/s1 |
| InChIKey | RKQYLIRYSFBZJY-IBGZPJMESA-N |
| XLogP | 2.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|