C25H24O2 — CID 166441676
ethyl (1R)-1-benzyl-2,2-diphenylcyclopropane-1-carboxylate (PubChem CID 166441676) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is ethyl (1R)-1-benzyl-2,2-diphenylcyclopropane-1-carboxylate.
| Compound Name | ethyl (1R)-1-benzyl-2,2-diphenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 166441676 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | ethyl (1R)-1-benzyl-2,2-diphenylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24O2/c1-2-27-23(26)24(18-20-12-6-3-7-13-20)19-25(24,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17H,2,18-19H2,1H3/t24-/m0/s1 |
| InChIKey | JVMKLQDYYFUYRR-DEOSSOPVSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |