C27H28O4 — CID 141017427
ethyl 5,5-diphenyl-2-(2-phenylethyl)-1,3-dioxane-2-carboxylate (PubChem CID 141017427) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is ethyl 5,5-diphenyl-2-(2-phenylethyl)-1,3-dioxane-2-carboxylate.
| Compound Name | ethyl 5,5-diphenyl-2-(2-phenylethyl)-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 141017427 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ethyl 5,5-diphenyl-2-(2-phenylethyl)-1,3-dioxane-2-carboxylate |
| SMILES | CCOC(=O)C1(CCc2ccccc2)OCC(c2ccccc2)(c2ccccc2)CO1 |
| InChI | InChI=1S/C27H28O4/c1-2-29-25(28)27(19-18-22-12-6-3-7-13-22)30-20-26(21-31-27,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17H,2,18-21H2,1H3 |
| InChIKey | TUSDFJSPUGTFGV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |