C16H20O3 — CID 102068340
ethyl (1S,6R,8S)-8-phenyl-7-oxabicyclo[4.2.0]octane-8-carboxylate (PubChem CID 102068340) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is ethyl (1S,6R,8S)-8-phenyl-7-oxabicyclo[4.2.0]octane-8-carboxylate.
| Compound Name | ethyl (1S,6R,8S)-8-phenyl-7-oxabicyclo[4.2.0]octane-8-carboxylate |
|---|---|
| PubChem CID | 102068340 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | ethyl (1S,6R,8S)-8-phenyl-7-oxabicyclo[4.2.0]octane-8-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccccc2)O[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C16H20O3/c1-2-18-15(17)16(12-8-4-3-5-9-12)13-10-6-7-11-14(13)19-16/h3-5,8-9,13-14H,2,6-7,10-11H2,1H3/t13-,14+,16+/m0/s1 |
| InChIKey | IVBGEQSZGHUGRF-SQWLQELKSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |