C15H18O2 — CID 125469612
ethyl (1S,5S,6R)-1-phenylbicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 125469612) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is ethyl (1S,5S,6R)-1-phenylbicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethyl (1S,5S,6R)-1-phenylbicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 125469612 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | ethyl (1S,5S,6R)-1-phenylbicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CCC[C@@]12c1ccccc1 |
| InChI | InChI=1S/C15H18O2/c1-2-17-14(16)13-12-9-6-10-15(12,13)11-7-4-3-5-8-11/h3-5,7-8,12-13H,2,6,9-10H2,1H3/t12-,13-,15-/m0/s1 |
| InChIKey | WPNHDPFWGIGQLR-YDHLFZDLSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |