C13H14O2 — CID 129353718
(1S,5R,6R)-1-phenylbicyclo[3.1.0]hexane-6-carboxylic acid (PubChem CID 129353718) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1S,5R,6R)-1-phenylbicyclo[3.1.0]hexane-6-carboxylic acid.
| Compound Name | (1S,5R,6R)-1-phenylbicyclo[3.1.0]hexane-6-carboxylic acid |
|---|---|
| PubChem CID | 129353718 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1S,5R,6R)-1-phenylbicyclo[3.1.0]hexane-6-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2CCC[C@]21c1ccccc1 |
| InChI | InChI=1S/C13H14O2/c14-12(15)11-10-7-4-8-13(10,11)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2,(H,14,15)/t10-,11+,13+/m1/s1 |
| InChIKey | QHMYGBYQLGBKGQ-MDZLAQPJSA-N |
| XLogP | 2.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |