C22H30O2 — CID 101386328
[2-methyl-1-[(1S,6R)-1-phenyl-7-bicyclo[4.1.0]heptanyl]prop-1-enyl] 2,2-dimethylpropanoate (PubChem CID 101386328) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is [2-methyl-1-[(1S,6R)-1-phenyl-7-bicyclo[4.1.0]heptanyl]prop-1-enyl] 2,2-dimethylpropanoate.
| Compound Name | [2-methyl-1-[(1S,6R)-1-phenyl-7-bicyclo[4.1.0]heptanyl]prop-1-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101386328 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | [2-methyl-1-[(1S,6R)-1-phenyl-7-bicyclo[4.1.0]heptanyl]prop-1-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)=C(OC(=O)C(C)(C)C)C1[C@H]2CCCC[C@@]12c1ccccc1 |
| InChI | InChI=1S/C22H30O2/c1-15(2)19(24-20(23)21(3,4)5)18-17-13-9-10-14-22(17,18)16-11-7-6-8-12-16/h6-8,11-12,17-18H,9-10,13-14H2,1-5H3/t17-,18?,22+/m1/s1 |
| InChIKey | ANOFYOKIUHTLQD-SLNGMPHYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|