C24H28O2 — CID 135068975
[1-(2,2-diphenylcyclopropyl)-2-methylprop-1-enyl] 2,2-dimethylpropanoate (PubChem CID 135068975) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is [1-(2,2-diphenylcyclopropyl)-2-methylprop-1-enyl] 2,2-dimethylpropanoate.
| Compound Name | [1-(2,2-diphenylcyclopropyl)-2-methylprop-1-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135068975 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [1-(2,2-diphenylcyclopropyl)-2-methylprop-1-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)=C(OC(=O)C(C)(C)C)C1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28O2/c1-17(2)21(26-22(25)23(3,4)5)20-16-24(20,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20H,16H2,1-5H3 |
| InChIKey | JCCQZBPDBYSQOK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|