C14H18IO2+ — CID 134877789
[(Z)-2-(2,2-dimethylpropanoyloxy)prop-1-enyl]-phenyliodanium (PubChem CID 134877789) has the molecular formula C14H18IO2+ and a molecular weight of 345.20 g/mol. Its IUPAC name is [(Z)-2-(2,2-dimethylpropanoyloxy)prop-1-enyl]-phenyliodanium.
| Compound Name | [(Z)-2-(2,2-dimethylpropanoyloxy)prop-1-enyl]-phenyliodanium |
|---|---|
| PubChem CID | 134877789 |
| Molecular Formula | C14H18IO2+ |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | [(Z)-2-(2,2-dimethylpropanoyloxy)prop-1-enyl]-phenyliodanium |
| SMILES | C/C(=C/[I+]c1ccccc1)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H18IO2/c1-11(17-13(16)14(2,3)4)10-15-12-8-6-5-7-9-12/h5-10H,1-4H3/q+1/b11-10- |
| InChIKey | DIUCLMBNLPCBON-KHPPLWFESA-N |
| XLogP | 0.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|