C12H15ClI+ — CID 10763951
[(Z)-2-chloro-3,3-dimethylbut-1-enyl]-phenyliodanium (PubChem CID 10763951) has the molecular formula C12H15ClI+ and a molecular weight of 321.61 g/mol. Its IUPAC name is [(Z)-2-chloro-3,3-dimethylbut-1-enyl]-phenyliodanium.
| Compound Name | [(Z)-2-chloro-3,3-dimethylbut-1-enyl]-phenyliodanium |
|---|---|
| PubChem CID | 10763951 |
| Molecular Formula | C12H15ClI+ |
| Molecular Weight | 321.61 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | [(Z)-2-chloro-3,3-dimethylbut-1-enyl]-phenyliodanium |
| SMILES | CC(C)(C)/C(Cl)=C/[I+]c1ccccc1 |
| InChI | InChI=1S/C12H15ClI/c1-12(2,3)11(13)9-14-10-7-5-4-6-8-10/h4-9H,1-3H3/q+1/b11-9- |
| InChIKey | DZWLCJSHZFFRNA-LUAWRHEFSA-N |
| XLogP | 1.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.61 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|