C12H15ClS — CID 125477364
[(Z)-2-chloro-3,3-dimethylbut-1-enyl]sulfanylbenzene (PubChem CID 125477364) has the molecular formula C12H15ClS and a molecular weight of 226.77 g/mol. Its IUPAC name is [(Z)-2-chloro-3,3-dimethylbut-1-enyl]sulfanylbenzene.
| Compound Name | [(Z)-2-chloro-3,3-dimethylbut-1-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 125477364 |
| Molecular Formula | C12H15ClS |
| Molecular Weight | 226.77 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | [(Z)-2-chloro-3,3-dimethylbut-1-enyl]sulfanylbenzene |
| SMILES | CC(C)(C)/C(Cl)=C/Sc1ccccc1 |
| InChI | InChI=1S/C12H15ClS/c1-12(2,3)11(13)9-14-10-7-5-4-6-8-10/h4-9H,1-3H3/b11-9- |
| InChIKey | FWSDGOJJENPZGF-LUAWRHEFSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.77 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |