C14H19IOS — CID 134996642
(Z)-2-iodo-3,4,4-trimethyl-1-phenylsulfanylpent-1-en-3-ol (PubChem CID 134996642) has the molecular formula C14H19IOS and a molecular weight of 362.28 g/mol. Its IUPAC name is (Z)-2-iodo-3,4,4-trimethyl-1-phenylsulfanylpent-1-en-3-ol.
| Compound Name | (Z)-2-iodo-3,4,4-trimethyl-1-phenylsulfanylpent-1-en-3-ol |
|---|---|
| PubChem CID | 134996642 |
| Molecular Formula | C14H19IOS |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (Z)-2-iodo-3,4,4-trimethyl-1-phenylsulfanylpent-1-en-3-ol |
| SMILES | CC(C)(C)C(C)(O)/C(I)=C/Sc1ccccc1 |
| InChI | InChI=1S/C14H19IOS/c1-13(2,3)14(4,16)12(15)10-17-11-8-6-5-7-9-11/h5-10,16H,1-4H3/b12-10- |
| InChIKey | RJXDMLBHKMAONI-BENRWUELSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|