C17H19NS2 — CID 5246314
N,N-dimethyl-2,3-bis(phenylsulfanyl)prop-2-en-1-amine (PubChem CID 5246314) has the molecular formula C17H19NS2 and a molecular weight of 301.48 g/mol. Its IUPAC name is N,N-dimethyl-2,3-bis(phenylsulfanyl)prop-2-en-1-amine.
| Compound Name | N,N-dimethyl-2,3-bis(phenylsulfanyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 5246314 |
| Molecular Formula | C17H19NS2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N,N-dimethyl-2,3-bis(phenylsulfanyl)prop-2-en-1-amine |
| SMILES | CN(C)CC(=CSc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C17H19NS2/c1-18(2)13-17(20-16-11-7-4-8-12-16)14-19-15-9-5-3-6-10-15/h3-12,14H,13H2,1-2H3 |
| InChIKey | FNIXCBRAIQIRPN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |