C20H24O2S2 — CID 71379103
(4,4-diethoxy-1-phenylsulfanylbut-1-en-2-yl)sulfanylbenzene (PubChem CID 71379103) has the molecular formula C20H24O2S2 and a molecular weight of 360.54 g/mol. Its IUPAC name is (4,4-diethoxy-1-phenylsulfanylbut-1-en-2-yl)sulfanylbenzene.
| Compound Name | (4,4-diethoxy-1-phenylsulfanylbut-1-en-2-yl)sulfanylbenzene |
|---|---|
| PubChem CID | 71379103 |
| Molecular Formula | C20H24O2S2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (4,4-diethoxy-1-phenylsulfanylbut-1-en-2-yl)sulfanylbenzene |
| SMILES | CCOC(CC(=CSc1ccccc1)Sc1ccccc1)OCC |
| InChI | InChI=1S/C20H24O2S2/c1-3-21-20(22-4-2)15-19(24-18-13-9-6-10-14-18)16-23-17-11-7-5-8-12-17/h5-14,16,20H,3-4,15H2,1-2H3 |
| InChIKey | PRXQJFQIRCWCNQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|