C25H25NS2 — CID 67542990
phenyl N-phenyl-2-(phenylsulfanylmethylidene)hexanimidothioate (PubChem CID 67542990) has the molecular formula C25H25NS2 and a molecular weight of 403.62 g/mol. Its IUPAC name is phenyl N-phenyl-2-(phenylsulfanylmethylidene)hexanimidothioate.
| Compound Name | phenyl N-phenyl-2-(phenylsulfanylmethylidene)hexanimidothioate |
|---|---|
| PubChem CID | 67542990 |
| Molecular Formula | C25H25NS2 |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | phenyl N-phenyl-2-(phenylsulfanylmethylidene)hexanimidothioate |
| SMILES | CCCCC(=CSc1ccccc1)/C(=N\c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C25H25NS2/c1-2-3-13-21(20-27-23-16-9-5-10-17-23)25(26-22-14-7-4-8-15-22)28-24-18-11-6-12-19-24/h4-12,14-20H,2-3,13H2,1H3/b21-20?,26-25+ |
| InChIKey | UNWIXDLZTHVGMC-KSIXHVBESA-N |
| XLogP | 8.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|