C31H28S4 — CID 11364539
[(1Z,6Z)-1,6,7-tris(phenylsulfanyl)hepta-1,6-dien-2-yl]sulfanylbenzene (PubChem CID 11364539) has the molecular formula C31H28S4 and a molecular weight of 528.83 g/mol. Its IUPAC name is [(1Z,6Z)-1,6,7-tris(phenylsulfanyl)hepta-1,6-dien-2-yl]sulfanylbenzene.
| Compound Name | [(1Z,6Z)-1,6,7-tris(phenylsulfanyl)hepta-1,6-dien-2-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 11364539 |
| Molecular Formula | C31H28S4 |
| Molecular Weight | 528.83 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | [(1Z,6Z)-1,6,7-tris(phenylsulfanyl)hepta-1,6-dien-2-yl]sulfanylbenzene |
| SMILES | C(\Sc1ccccc1)=C(/CCC/C(=C/Sc1ccccc1)Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C31H28S4/c1-5-14-26(15-6-1)32-24-30(34-28-18-9-3-10-19-28)22-13-23-31(35-29-20-11-4-12-21-29)25-33-27-16-7-2-8-17-27/h1-12,14-21,24-25H,13,22-23H2/b30-24-,31-25- |
| InChIKey | DTSLGRXCVFOFJU-ZPEMYOGYSA-N |
| XLogP | 11.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.83 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |