C32H28Br2S2 — CID 102303023
1-bromo-4-[(1Z,7Z)-7-(4-bromophenyl)sulfanyl-1,8-diphenylocta-1,7-dien-2-yl]sulfanylbenzene (PubChem CID 102303023) has the molecular formula C32H28Br2S2 and a molecular weight of 636.52 g/mol. Its IUPAC name is 1-bromo-4-[(1Z,7Z)-7-(4-bromophenyl)sulfanyl-1,8-diphenylocta-1,7-dien-2-yl]sulfanylbenzene.
| Compound Name | 1-bromo-4-[(1Z,7Z)-7-(4-bromophenyl)sulfanyl-1,8-diphenylocta-1,7-dien-2-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 102303023 |
| Molecular Formula | C32H28Br2S2 |
| Molecular Weight | 636.52 g/mol |
| Exact Mass | 634.00 |
| IUPAC Name | 1-bromo-4-[(1Z,7Z)-7-(4-bromophenyl)sulfanyl-1,8-diphenylocta-1,7-dien-2-yl]sulfanylbenzene |
| SMILES | Brc1ccc(S/C(=C\c2ccccc2)CCCC/C(=C/c2ccccc2)Sc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C32H28Br2S2/c33-27-15-19-29(20-16-27)35-31(23-25-9-3-1-4-10-25)13-7-8-14-32(24-26-11-5-2-6-12-26)36-30-21-17-28(34)18-22-30/h1-6,9-12,15-24H,7-8,13-14H2/b31-23-,32-24- |
| InChIKey | LAHCIIMWKYHSNC-PUHRYQSPSA-N |
| XLogP | 11.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.52 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|