C31H26Br2 — CID 101013816
1-bromo-4-[(1Z,6Z)-7-(4-bromophenyl)-2,6-diphenylhepta-1,6-dienyl]benzene (PubChem CID 101013816) has the molecular formula C31H26Br2 and a molecular weight of 558.36 g/mol. Its IUPAC name is 1-bromo-4-[(1Z,6Z)-7-(4-bromophenyl)-2,6-diphenylhepta-1,6-dienyl]benzene.
| Compound Name | 1-bromo-4-[(1Z,6Z)-7-(4-bromophenyl)-2,6-diphenylhepta-1,6-dienyl]benzene |
|---|---|
| PubChem CID | 101013816 |
| Molecular Formula | C31H26Br2 |
| Molecular Weight | 558.36 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 1-bromo-4-[(1Z,6Z)-7-(4-bromophenyl)-2,6-diphenylhepta-1,6-dienyl]benzene |
| SMILES | Brc1ccc(/C=C(/CCC/C(=C/c2ccc(Br)cc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26Br2/c32-30-18-14-24(15-19-30)22-28(26-8-3-1-4-9-26)12-7-13-29(27-10-5-2-6-11-27)23-25-16-20-31(33)21-17-25/h1-6,8-11,14-23H,7,12-13H2/b28-22-,29-23- |
| InChIKey | USJOKQMAVAYKEM-UNVYMFJTSA-N |
| XLogP | 10.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.36 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|