C17H16O — CID 102069655
(Z)-4,5-diphenylpent-4-enal (PubChem CID 102069655) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is (Z)-4,5-diphenylpent-4-enal.
| Compound Name | (Z)-4,5-diphenylpent-4-enal |
|---|---|
| PubChem CID | 102069655 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (Z)-4,5-diphenylpent-4-enal |
| SMILES | O=CCC/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16O/c18-13-7-12-17(16-10-5-2-6-11-16)14-15-8-3-1-4-9-15/h1-6,8-11,13-14H,7,12H2/b17-14- |
| InChIKey | MWGNYFUOTJMAHE-VKAVYKQESA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|