C17H18O2 — CID 67713880
2-[(E)-2,3-diphenylprop-2-enoxy]ethanol (PubChem CID 67713880) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[(E)-2,3-diphenylprop-2-enoxy]ethanol.
| Compound Name | 2-[(E)-2,3-diphenylprop-2-enoxy]ethanol |
|---|---|
| PubChem CID | 67713880 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[(E)-2,3-diphenylprop-2-enoxy]ethanol |
| SMILES | OCCOC/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18O2/c18-11-12-19-14-17(16-9-5-2-6-10-16)13-15-7-3-1-4-8-15/h1-10,13,18H,11-12,14H2/b17-13- |
| InChIKey | KITCOBMLQHAPCC-LGMDPLHJSA-N |
| XLogP | 3.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|