C16H13BrO — CID 5475883
(Z)-2-(bromomethyl)-1,3-diphenylprop-2-en-1-one (PubChem CID 5475883) has the molecular formula C16H13BrO and a molecular weight of 301.18 g/mol. Its IUPAC name is (Z)-2-(bromomethyl)-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-2-(bromomethyl)-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 5475883 |
| Molecular Formula | C16H13BrO |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | (Z)-2-(bromomethyl)-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccccc1)CBr)c1ccccc1 |
| InChI | InChI=1S/C16H13BrO/c17-12-15(11-13-7-3-1-4-8-13)16(18)14-9-5-2-6-10-14/h1-11H,12H2/b15-11+ |
| InChIKey | UODNKPNEWOIIAE-RVDMUPIBSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|