C30H22O2S — CID 11476367
(Z)-2-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]sulfanyl-1,3-diphenylprop-2-en-1-one (PubChem CID 11476367) has the molecular formula C30H22O2S and a molecular weight of 446.57 g/mol. Its IUPAC name is (Z)-2-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]sulfanyl-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-2-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]sulfanyl-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 11476367 |
| Molecular Formula | C30H22O2S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (Z)-2-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]sulfanyl-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccccc1)S/C(=C\c1ccccc1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H22O2S/c31-29(25-17-9-3-10-18-25)27(21-23-13-5-1-6-14-23)33-28(22-24-15-7-2-8-16-24)30(32)26-19-11-4-12-20-26/h1-22H/b27-21-,28-22- |
| InChIKey | YPXAUZRZCYCVSO-ZDSKVHJSSA-N |
| XLogP | 7.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|