About (E)-3,4-diphenylbut-3-enethial
(E)-3,4-diphenylbut-3-enethial (PubChem CID 87918444) has the molecular formula C16H14S
and a molecular weight of 238.36 g/mol. Its IUPAC name is (E)-3,4-diphenylbut-3-enethial.
Molecular Properties
| Compound Name | (E)-3,4-diphenylbut-3-enethial |
| PubChem CID | 87918444 |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (E)-3,4-diphenylbut-3-enethial |
| SMILES | S=CC/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14S/c17-12-11-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-10,12-13H,11H2/b16-13+ |
| InChIKey | NJCKVCXRWUJPOM-DTQAZKPQSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,4-diphenylbut-3-enethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,4-diphenylbut-3-enethial?
The IUPAC name of (E)-3,4-diphenylbut-3-enethial (CID 87918444) is (E)-3,4-diphenylbut-3-enethial.
What is the SMILES notation for (E)-3,4-diphenylbut-3-enethial?
The canonical SMILES for (E)-3,4-diphenylbut-3-enethial is S=CC/C(=C\c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-3,4-diphenylbut-3-enethial?
The InChIKey is NJCKVCXRWUJPOM-DTQAZKPQSA-N. The full InChI is InChI=1S/C16H14S/c17-12-11-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-10,12-13H,11H2/b16-13+.
What are the key properties of (E)-3,4-diphenylbut-3-enethial?
(E)-3,4-diphenylbut-3-enethial has a molecular weight of 238.36 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,4-diphenylbut-3-enethial is sourced from PubChem (CID 87918444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).