C15H15NO3S — CID 174655398
2,3-diphenylprop-2-enylsulfamic acid (PubChem CID 174655398) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2,3-diphenylprop-2-enylsulfamic acid.
| Compound Name | 2,3-diphenylprop-2-enylsulfamic acid |
|---|---|
| PubChem CID | 174655398 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2,3-diphenylprop-2-enylsulfamic acid |
| SMILES | O=S(=O)(O)NCC(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO3S/c17-20(18,19)16-12-15(14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-11,16H,12H2,(H,17,18,19) |
| InChIKey | IFBUOSBDSKRBDT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|