C8H8CaO6S2 — CID 172794141
CID 172794141 (PubChem CID 172794141) has the molecular formula C8H8CaO6S2 and a molecular weight of 304.36 g/mol.
| Compound Name | CID 172794141 |
|---|---|
| PubChem CID | 172794141 |
| Molecular Formula | C8H8CaO6S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 303.94 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)C(=Cc1ccccc1)S(=O)(=O)O.[Ca] |
| InChI | InChI=1S/C8H8O6S2.Ca/c9-15(10,11)8(16(12,13)14)6-7-4-2-1-3-5-7;/h1-6H,(H,9,10,11)(H,12,13,14); |
| InChIKey | PYVSMFFTMFNDGJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|