C14H13NO2S — CID 54513105
1,2-diphenylethenesulfonamide (PubChem CID 54513105) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 1,2-diphenylethenesulfonamide.
| Compound Name | 1,2-diphenylethenesulfonamide |
|---|---|
| PubChem CID | 54513105 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 1,2-diphenylethenesulfonamide |
| SMILES | NS(=O)(=O)C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13NO2S/c15-18(16,17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H2,15,16,17) |
| InChIKey | YKNJFMGWVKOOJS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|