C21H21NO3S — CID 5351957
(Z)-1,2-diphenylethenesulfonic acid;4-methylaniline (PubChem CID 5351957) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is (Z)-1,2-diphenylethenesulfonic acid;4-methylaniline.
| Compound Name | (Z)-1,2-diphenylethenesulfonic acid;4-methylaniline |
|---|---|
| PubChem CID | 5351957 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (Z)-1,2-diphenylethenesulfonic acid;4-methylaniline |
| SMILES | Cc1ccc(N)cc1.O=S(=O)(O)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3S.C7H9N/c15-18(16,17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12;1-6-2-4-7(8)5-3-6/h1-11H,(H,15,16,17);2-5H,8H2,1H3/b14-11-; |
| InChIKey | HVOIJEDWGMIDLA-IRIIKGHASA-N |
| XLogP | 4.65 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|