C17H16N2O — CID 66616036
2,4-diamino-1,5-diphenylpenta-1,4-dien-3-one (PubChem CID 66616036) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 2,4-diamino-1,5-diphenylpenta-1,4-dien-3-one.
| Compound Name | 2,4-diamino-1,5-diphenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 66616036 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2,4-diamino-1,5-diphenylpenta-1,4-dien-3-one |
| SMILES | NC(=Cc1ccccc1)C(=O)C(N)=Cc1ccccc1 |
| InChI | InChI=1S/C17H16N2O/c18-15(11-13-7-3-1-4-8-13)17(20)16(19)12-14-9-5-2-6-10-14/h1-12H,18-19H2 |
| InChIKey | NJJQKUCTKNDSPO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|