germane;2-hydroxy-3-phenylprop-2-enoic acid

C9H16Ge2O3 — CID 174439173

IUPACgermane;2-hydroxy-3-phenylprop-2-enoic acid
SMILESO=C(O)C(O)=Cc1ccccc1.[GeH4].[GeH4]
InChIInChI=1S/C9H8O3.2GeH4/c10-8(9(11)12)6-7-4-2-1-3-5-7;;/h1-6,10H,(H,11,12);2*1H4
InChIKeyRMPLWEBNUUODCG-UHFFFAOYSA-N
MW317.44 g/mol
LogP-1.23
Rot. Bonds2

About germane;2-hydroxy-3-phenylprop-2-enoic acid

germane;2-hydroxy-3-phenylprop-2-enoic acid (PubChem CID 174439173) has the molecular formula C9H16Ge2O3 and a molecular weight of 317.44 g/mol. Its IUPAC name is germane;2-hydroxy-3-phenylprop-2-enoic acid.

Molecular Properties

Compound Namegermane;2-hydroxy-3-phenylprop-2-enoic acid
PubChem CID174439173
Molecular FormulaC9H16Ge2O3
Molecular Weight317.44 g/mol
Exact Mass319.95
IUPAC Namegermane;2-hydroxy-3-phenylprop-2-enoic acid
SMILESO=C(O)C(O)=Cc1ccccc1.[GeH4].[GeH4]
InChIInChI=1S/C9H8O3.2GeH4/c10-8(9(11)12)6-7-4-2-1-3-5-7;;/h1-6,10H,(H,11,12);2*1H4
InChIKeyRMPLWEBNUUODCG-UHFFFAOYSA-N
XLogP-1.23
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.44
LogP ≤ 5-1.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze germane;2-hydroxy-3-phenylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of germane;2-hydroxy-3-phenylprop-2-enoic acid?
The IUPAC name of germane;2-hydroxy-3-phenylprop-2-enoic acid (CID 174439173) is germane;2-hydroxy-3-phenylprop-2-enoic acid.
What is the SMILES notation for germane;2-hydroxy-3-phenylprop-2-enoic acid?
The canonical SMILES for germane;2-hydroxy-3-phenylprop-2-enoic acid is O=C(O)C(O)=Cc1ccccc1.[GeH4].[GeH4].
What is the InChIKey of germane;2-hydroxy-3-phenylprop-2-enoic acid?
The InChIKey is RMPLWEBNUUODCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3.2GeH4/c10-8(9(11)12)6-7-4-2-1-3-5-7;;/h1-6,10H,(H,11,12);2*1H4.
What are the key properties of germane;2-hydroxy-3-phenylprop-2-enoic acid?
germane;2-hydroxy-3-phenylprop-2-enoic acid has a molecular weight of 317.44 g/mol, XLogP of -1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for germane;2-hydroxy-3-phenylprop-2-enoic acid is sourced from PubChem (CID 174439173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).